摘要:
A fluorine-containing diene represented by the formula 1: CF2nullCF(CF2)nCXYOCFnullCF2nullnullFormula 1 wherein each of X and Y which are independent of each other, is an atom selected from a hydrogen atom, a fluorine atom, a chlorine atom, a bromine atom and an iodine atom, provided that X and Y are not simultaneously hydrogen atoms or fluorine atoms, and n is an integer of from 1 to 3.
摘要:
A novel polymer useful as an optical resin material excellent in heat resistance, a novel monomer for obtaining the polymer, etc., are provided. A fluorinated diene represented by CF2nullCF(CF2)nC(CF3)ROCFnullCF2 (wherein R is a fluorine atom or a trifluoromethyl group, and n is an integer of from 1 to 3), and a polymer thereof.
摘要:
A fluorine-containing diene represented by the formula 1: CF2nullCF(CF2)nCXYOCFnullCF2nullnullFormula 1 wherein each of X and Y which are independent of each other, is an atom selected from a hydrogen atom, a fluorine atom, a chlorine atom, a bromine atom and an iodine atom, provided that X and Y are not simultaneously hydrogen atoms or fluorine atoms, and n is an integer of from 1 to 3.
摘要:
A fluorosulfonyl group-containing compound having a high polymerization reactivity, a process for its production, a sulfonyl group-containing polymerizable monomer led from the sulfonyl group-containing compound, and a polymer obtainable by polymerizing the sulfonyl group-containing polymerizable monomer, are provided. A compound (3) is fluorinated to form a compound (4), and then, the compound (4) is subjected to a decomposition reaction to produce a compound (5). A preferred compound (5-1) of the compound (5) is thermally decomposed to produce a compound (7-1) having a high polymerization reactivity. 1 wherein RA is a bivalent organic group such as a fluoroalkylene group, RAF is a group having RA fluorinated, or the same group as RA, each of RB to RD which are independent of one another, is a hydrogen atom, etc., each of RBF to RDF is a fluorine atom, etc., RE is a monovalent organic group, REF is a group having RE fluorinated, or the same group as RE, E is a bivalent connecting group, EF is the same group as E, or a group having E fluorinated, EF1 is a group formed by scission of EF, each of X1 to X3 is a hydrogen atom, etc., and each of X1F to X3F is a fluorine atom, etc.
摘要:
A novel fluoropolymer which can be an optical resin material having a low refractive index and excellent heat resistance, and a novel fluorinated diene compound having two unsaturated bonds, capable of presenting such a fluoropolymer, are presented. Further, by virtue of the low refractive index and excellent heat resistance, the polymer presents a high performance optical transmitter and a plastic optical fiber. A fluorinated diene compound represented by CF2nullCFCF(ORf)CF2OCFnullCF2 (wherein Rf is a perfluoroalkyl group such as a trifluoromethyl group), and a fluoropolymer thereof. Further, an optical transmitter made by using such a fluoropolymer, and a plastic optical fiber having a core comprising such a fluoropolymer and a fluorinated low molecular compound contained therein as a refractive index-increasing agent.